C17H34O2Si — CID 177483375
[(E)-1-[(2S,6S)-6-hexyloxan-2-yl]oxyprop-1-en-2-yl]-trimethylsilane (PubChem CID 177483375) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is [(E)-1-[(2S,6S)-6-hexyloxan-2-yl]oxyprop-1-en-2-yl]-trimethylsilane.
| Compound Name | [(E)-1-[(2S,6S)-6-hexyloxan-2-yl]oxyprop-1-en-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 177483375 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | [(E)-1-[(2S,6S)-6-hexyloxan-2-yl]oxyprop-1-en-2-yl]-trimethylsilane |
| SMILES | CCCCCC[C@H]1CCC[C@H](O/C=C(\C)[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H34O2Si/c1-6-7-8-9-11-16-12-10-13-17(19-16)18-14-15(2)20(3,4)5/h14,16-17H,6-13H2,1-5H3/b15-14+/t16-,17+/m0/s1 |
| InChIKey | ACJDARXEATXFJG-WEEZADPSSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|