C26H36O2 — CID 101198516
[(1S,6S)-3,4-dimethyl-6-(4-methylphenyl)cyclohex-3-en-1-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 101198516) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is [(1S,6S)-3,4-dimethyl-6-(4-methylphenyl)cyclohex-3-en-1-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(1S,6S)-3,4-dimethyl-6-(4-methylphenyl)cyclohex-3-en-1-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 101198516 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | [(1S,6S)-3,4-dimethyl-6-(4-methylphenyl)cyclohex-3-en-1-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | CC1=C(C)C[C@H](c2ccc(C)cc2)[C@@H](C(=O)[C@@]2(O)C[C@H]3CC[C@]2(C)C3(C)C)C1 |
| InChI | InChI=1S/C26H36O2/c1-16-7-9-19(10-8-16)21-13-17(2)18(3)14-22(21)23(27)26(28)15-20-11-12-25(26,6)24(20,4)5/h7-10,20-22,28H,11-15H2,1-6H3/t20-,21-,22+,25-,26+/m1/s1 |
| InChIKey | KXMWGTBLLJNSCT-QITSPOGCSA-N |
| XLogP | 5.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|