C21H35BrO3Si — CID 101199008
[(2R,3aS,5R,6S,8Z,10aS)-2-(3-bromopropa-1,2-dienyl)-5-ethyl-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-6-yl]oxy-triethylsilane (PubChem CID 101199008) has the molecular formula C21H35BrO3Si and a molecular weight of 443.50 g/mol. Its IUPAC name is [(2R,3aS,5R,6S,8Z,10aS)-2-(3-bromopropa-1,2-dienyl)-5-ethyl-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-6-yl]oxy-triethylsilane.
| Compound Name | [(2R,3aS,5R,6S,8Z,10aS)-2-(3-bromopropa-1,2-dienyl)-5-ethyl-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-6-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 101199008 |
| Molecular Formula | C21H35BrO3Si |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [(2R,3aS,5R,6S,8Z,10aS)-2-(3-bromopropa-1,2-dienyl)-5-ethyl-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-6-yl]oxy-triethylsilane |
| SMILES | CC[C@H]1O[C@H]2C[C@H](C=C=CBr)O[C@H]2C/C=C\C[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H35BrO3Si/c1-5-18-20(25-26(6-2,7-3)8-4)14-10-9-13-19-21(24-18)16-17(23-19)12-11-15-22/h9-10,12,15,17-21H,5-8,13-14,16H2,1-4H3/b10-9-/t11?,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | OVBDFSVEHLODQI-UNRWHZLESA-N |
| XLogP | 6.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|