C21H38O4Si — CID 11773492
(E)-3-[(2R,3aS,5R,6R,8Z,10aS)-5-ethyl-6-triethylsilyloxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-2-yl]prop-2-en-1-ol (PubChem CID 11773492) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is (E)-3-[(2R,3aS,5R,6R,8Z,10aS)-5-ethyl-6-triethylsilyloxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-2-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(2R,3aS,5R,6R,8Z,10aS)-5-ethyl-6-triethylsilyloxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11773492 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (E)-3-[(2R,3aS,5R,6R,8Z,10aS)-5-ethyl-6-triethylsilyloxy-2,3,3a,5,6,7,10,10a-octahydrofuro[3,2-b]oxonin-2-yl]prop-2-en-1-ol |
| SMILES | CC[C@H]1O[C@H]2C[C@H](/C=C/CO)O[C@H]2C/C=C\C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H38O4Si/c1-5-18-20(25-26(6-2,7-3)8-4)14-10-9-13-19-21(24-18)16-17(23-19)12-11-15-22/h9-12,17-22H,5-8,13-16H2,1-4H3/b10-9-,12-11+/t17-,18+,19-,20+,21-/m0/s1 |
| InChIKey | CGHJUQZBIXSVJN-QTXLTJSASA-N |
| XLogP | 4.60 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|