C18H34O5Si — CID 11035735
(E)-3-[(2S,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5-[(E)-prop-1-enyl]oxolan-2-yl]prop-2-en-1-ol (PubChem CID 11035735) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (E)-3-[(2S,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5-[(E)-prop-1-enyl]oxolan-2-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(2S,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5-[(E)-prop-1-enyl]oxolan-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11035735 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (E)-3-[(2S,3S,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5-[(E)-prop-1-enyl]oxolan-2-yl]prop-2-en-1-ol |
| SMILES | C/C=C/[C@H]1O[C@@H](/C=C/CO)[C@H](OCOC)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O5Si/c1-8-10-14-17(23-24(6,7)18(2,3)4)16(21-13-20-5)15(22-14)11-9-12-19/h8-11,14-17,19H,12-13H2,1-7H3/b10-8+,11-9+/t14-,15+,16+,17+/m1/s1 |
| InChIKey | VGJAGIOSLOQIST-FLEMJBRTSA-N |
| XLogP | 3.26 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|