C17H34O4Si — CID 16756355
(E)-3-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-en-1-ol (PubChem CID 16756355) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (E)-3-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-en-1-ol.
| Compound Name | (E)-3-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 16756355 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (E)-3-[(4S,5S)-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-en-1-ol |
| SMILES | C/C(=C\CO)[C@@H]1OC(C)(C)O[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O4Si/c1-13(9-11-18)15-14(20-17(5,6)21-15)10-12-19-22(7,8)16(2,3)4/h9,14-15,18H,10-12H2,1-8H3/b13-9+/t14-,15-/m0/s1 |
| InChIKey | NGCIBPNCVALZRV-FQSSWDBKSA-N |
| XLogP | 3.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|