C15H30O5Si — CID 139184179
(1S)-1-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,3,4-trimethoxycyclobuten-1-yl]ethanol (PubChem CID 139184179) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is (1S)-1-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,3,4-trimethoxycyclobuten-1-yl]ethanol.
| Compound Name | (1S)-1-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,3,4-trimethoxycyclobuten-1-yl]ethanol |
|---|---|
| PubChem CID | 139184179 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (1S)-1-[(4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,3,4-trimethoxycyclobuten-1-yl]ethanol |
| SMILES | COC1(OC)C=C([C@H](C)O)[C@@]1(OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O5Si/c1-11(16)12-10-14(17-5,18-6)15(12,19-7)20-21(8,9)13(2,3)4/h10-11,16H,1-9H3/t11-,15+/m0/s1 |
| InChIKey | FVRFQLNDDGDUNM-XHDPSFHLSA-N |
| XLogP | 2.66 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|