C15H30O4Si — CID 11822806
(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 11822806) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methoxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methoxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 11822806 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | COC1C=C[C@@H](O)[C@H](CC(C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C15H30O4Si/c1-11(19-20(6,7)15(2,3)4)10-13-12(16)8-9-14(17-5)18-13/h8-9,11-14,16H,10H2,1-7H3/t11?,12-,13+,14?/m1/s1 |
| InChIKey | JDCGFNDWCJATAN-DKNRTOFZSA-N |
| XLogP | 3.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|