C22H42O4Si — CID 10834724
(1E,3S,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]undeca-1,4-dien-3-ol (PubChem CID 10834724) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is (1E,3S,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]undeca-1,4-dien-3-ol.
| Compound Name | (1E,3S,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]undeca-1,4-dien-3-ol |
|---|---|
| PubChem CID | 10834724 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (1E,3S,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]undeca-1,4-dien-3-ol |
| SMILES | CCCCC[C@H](/C=C/[C@@H](O)/C=C/[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O4Si/c1-9-10-11-12-19(26-27(7,8)21(2,3)4)15-13-18(23)14-16-20-17-24-22(5,6)25-20/h13-16,18-20,23H,9-12,17H2,1-8H3/b15-13+,16-14+/t18-,19-,20+/m1/s1 |
| InChIKey | XMLMNCPNVYMQCJ-HAXAVQFMSA-N |
| XLogP | 5.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|