C16H32O4Si — CID 10980038
[(3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-ethoxyethoxy)cyclopenten-1-yl]methanol (PubChem CID 10980038) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is [(3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-ethoxyethoxy)cyclopenten-1-yl]methanol.
| Compound Name | [(3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-ethoxyethoxy)cyclopenten-1-yl]methanol |
|---|---|
| PubChem CID | 10980038 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | [(3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2-ethoxyethoxy)cyclopenten-1-yl]methanol |
| SMILES | CCOCCO[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C=C1CO |
| InChI | InChI=1S/C16H32O4Si/c1-7-18-8-9-19-15-11-14(10-13(15)12-17)20-21(5,6)16(2,3)4/h10,14-15,17H,7-9,11-12H2,1-6H3/t14-,15-/m0/s1 |
| InChIKey | IQODEFLVJGBGMW-GJZGRUSLSA-N |
| XLogP | 3.12 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|