C16H32O6Si — CID 11783021
(1S,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-ol (PubChem CID 11783021) has the molecular formula C16H32O6Si and a molecular weight of 348.51 g/mol. Its IUPAC name is (1S,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-ol.
| Compound Name | (1S,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11783021 |
| Molecular Formula | C16H32O6Si |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (1S,4S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-ol |
| SMILES | COCO[C@@H]1[C@@H](OCOC)C=C(CO[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C16H32O6Si/c1-16(2,3)23(6,7)22-9-12-8-13(20-10-18-4)15(14(12)17)21-11-19-5/h8,13-15,17H,9-11H2,1-7H3/t13-,14-,15+/m0/s1 |
| InChIKey | YPXTYBHTMJTGPF-SOUVJXGZSA-N |
| XLogP | 2.29 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|