C27H54O4Si — CID 10983566
(E,6R)-6-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]hex-2-ene-1,6-diol (PubChem CID 10983566) has the molecular formula C27H54O4Si and a molecular weight of 470.81 g/mol. Its IUPAC name is (E,6R)-6-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]hex-2-ene-1,6-diol.
| Compound Name | (E,6R)-6-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]hex-2-ene-1,6-diol |
|---|---|
| PubChem CID | 10983566 |
| Molecular Formula | C27H54O4Si |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | (E,6R)-6-[(2R,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]hex-2-ene-1,6-diol |
| SMILES | CCCCCCCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]([C@H](O)CC/C=C/CO)O1 |
| InChI | InChI=1S/C27H54O4Si/c1-7-8-9-10-11-12-13-16-19-26(31-32(5,6)27(2,3)4)25-21-20-24(30-25)23(29)18-15-14-17-22-28/h14,17,23-26,28-29H,7-13,15-16,18-22H2,1-6H3/b17-14+/t23-,24-,25-,26-/m1/s1 |
| InChIKey | OYKDXIKPFVEGAC-JQGZJAJHSA-N |
| XLogP | 7.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|