C16H34O3Si — CID 45141916
(E,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2-methyloct-2-en-1-ol (PubChem CID 45141916) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is (E,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2-methyloct-2-en-1-ol.
| Compound Name | (E,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2-methyloct-2-en-1-ol |
|---|---|
| PubChem CID | 45141916 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | (E,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-2-methyloct-2-en-1-ol |
| SMILES | CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C(\C)CO)OC |
| InChI | InChI=1S/C16H34O3Si/c1-9-10-14(15(18-6)11-13(2)12-17)19-20(7,8)16(3,4)5/h11,14-15,17H,9-10,12H2,1-8H3/b13-11+/t14-,15-/m0/s1 |
| InChIKey | IIQVZFNPOHGOOW-CYAURGIBSA-N |
| XLogP | 4.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|