C21H40O2Si — CID 135082484
(2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,10-trien-4-ol (PubChem CID 135082484) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,10-trien-4-ol.
| Compound Name | (2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,10-trien-4-ol |
|---|---|
| PubChem CID | 135082484 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (2E,6E)-1-[tert-butyl(dimethyl)silyl]oxy-3,7,11-trimethyldodeca-2,6,10-trien-4-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC(O)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O2Si/c1-17(2)11-10-12-18(3)13-14-20(22)19(4)15-16-23-24(8,9)21(5,6)7/h11,13,15,20,22H,10,12,14,16H2,1-9H3/b18-13+,19-15+ |
| InChIKey | ROCNAALIGNOJEF-HQSZAHFGSA-N |
| XLogP | 6.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|