C16H32O2Si — CID 10891402
(4R,7E)-9-[tert-butyl(dimethyl)silyl]oxy-7-methylnona-1,7-dien-4-ol (PubChem CID 10891402) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (4R,7E)-9-[tert-butyl(dimethyl)silyl]oxy-7-methylnona-1,7-dien-4-ol.
| Compound Name | (4R,7E)-9-[tert-butyl(dimethyl)silyl]oxy-7-methylnona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 10891402 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (4R,7E)-9-[tert-butyl(dimethyl)silyl]oxy-7-methylnona-1,7-dien-4-ol |
| SMILES | C=CC[C@H](O)CC/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O2Si/c1-8-9-15(17)11-10-14(2)12-13-18-19(6,7)16(3,4)5/h8,12,15,17H,1,9-11,13H2,2-7H3/b14-12+/t15-/m0/s1 |
| InChIKey | RZYXIXVVCXKWME-ZQHYZAEZSA-N |
| XLogP | 4.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|