C18H38O4Si2 — CID 11057858
(1R,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopent-2-en-1-ol (PubChem CID 11057858) has the molecular formula C18H38O4Si2 and a molecular weight of 374.67 g/mol. Its IUPAC name is (1R,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopent-2-en-1-ol.
| Compound Name | (1R,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11057858 |
| Molecular Formula | C18H38O4Si2 |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (1R,4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(hydroxymethyl)cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C=C(CO)[C@H]1O |
| InChI | InChI=1S/C18H38O4Si2/c1-17(2,3)23(7,8)21-14-11-13(12-19)15(20)16(14)22-24(9,10)18(4,5)6/h11,14-16,19-20H,12H2,1-10H3/t14-,15+,16+/m0/s1 |
| InChIKey | ZJFVJTRIVRGYCN-ARFHVFGLSA-N |
| XLogP | 4.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|