C23H50O4Si3 — CID 20614539
2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexylidene]ethanol (PubChem CID 20614539) has the molecular formula C23H50O4Si3 and a molecular weight of 474.91 g/mol. Its IUPAC name is 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexylidene]ethanol.
| Compound Name | 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexylidene]ethanol |
|---|---|
| PubChem CID | 20614539 |
| Molecular Formula | C23H50O4Si3 |
| Molecular Weight | 474.91 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-trimethylsilyloxycyclohexylidene]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(=CCO)CC(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C23H50O4Si3/c1-22(2,3)29(10,11)25-19-16-18(14-15-24)17-20(21(19)27-28(7,8)9)26-30(12,13)23(4,5)6/h14,19-21,24H,15-17H2,1-13H3/b18-14- |
| InChIKey | UUUHWUCWOKUGIZ-JXAWBTAJSA-N |
| XLogP | 6.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.91 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|