C21H35BrO3Si — CID 101237782
[(1S)-1-[(2R,3aS,5R,7Z,9aS)-2-(3-bromopropa-1,2-dienyl)-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-5-yl]propoxy]-tert-butyl-dimethylsilane (PubChem CID 101237782) has the molecular formula C21H35BrO3Si and a molecular weight of 443.50 g/mol. Its IUPAC name is [(1S)-1-[(2R,3aS,5R,7Z,9aS)-2-(3-bromopropa-1,2-dienyl)-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-5-yl]propoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-1-[(2R,3aS,5R,7Z,9aS)-2-(3-bromopropa-1,2-dienyl)-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-5-yl]propoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101237782 |
| Molecular Formula | C21H35BrO3Si |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [(1S)-1-[(2R,3aS,5R,7Z,9aS)-2-(3-bromopropa-1,2-dienyl)-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-5-yl]propoxy]-tert-butyl-dimethylsilane |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C/C=C\C[C@@H]2O[C@@H](C=C=CBr)C[C@@H]2O1 |
| InChI | InChI=1S/C21H35BrO3Si/c1-7-17(25-26(5,6)21(2,3)4)18-12-8-9-13-19-20(24-18)15-16(23-19)11-10-14-22/h8-9,11,14,16-20H,7,12-13,15H2,1-6H3/b9-8-/t10?,16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | NNAFOANBZDYXOF-FWZAUCOISA-N |
| XLogP | 6.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|