C17H32O2Si — CID 101012755
tert-butyl-dimethyl-[(1R)-1-[(2R)-4-methyl-2,5-dihydrofuran-2-yl]hex-5-enoxy]silane (PubChem CID 101012755) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-1-[(2R)-4-methyl-2,5-dihydrofuran-2-yl]hex-5-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R)-1-[(2R)-4-methyl-2,5-dihydrofuran-2-yl]hex-5-enoxy]silane |
|---|---|
| PubChem CID | 101012755 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-1-[(2R)-4-methyl-2,5-dihydrofuran-2-yl]hex-5-enoxy]silane |
| SMILES | C=CCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C=C(C)CO1 |
| InChI | InChI=1S/C17H32O2Si/c1-8-9-10-11-15(16-12-14(2)13-18-16)19-20(6,7)17(3,4)5/h8,12,15-16H,1,9-11,13H2,2-7H3/t15-,16-/m1/s1 |
| InChIKey | MFPPWRXKFNACPG-HZPDHXFCSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|