C21H36O3Si — CID 50941199
tert-butyl-[[(1R,2S,5E,8R)-9-(1-ethoxyethenyl)-6-methyl-11-oxabicyclo[6.2.1]undeca-5,9-dien-2-yl]oxy]-dimethylsilane (PubChem CID 50941199) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is tert-butyl-[[(1R,2S,5E,8R)-9-(1-ethoxyethenyl)-6-methyl-11-oxabicyclo[6.2.1]undeca-5,9-dien-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2S,5E,8R)-9-(1-ethoxyethenyl)-6-methyl-11-oxabicyclo[6.2.1]undeca-5,9-dien-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 50941199 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | tert-butyl-[[(1R,2S,5E,8R)-9-(1-ethoxyethenyl)-6-methyl-11-oxabicyclo[6.2.1]undeca-5,9-dien-2-yl]oxy]-dimethylsilane |
| SMILES | C=C(OCC)C1=C[C@H]2O[C@@H]1C/C(C)=C\CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-9-22-16(3)17-14-20-18(24-25(7,8)21(4,5)6)12-10-11-15(2)13-19(17)23-20/h11,14,18-20H,3,9-10,12-13H2,1-2,4-8H3/b15-11-/t18-,19+,20+/m0/s1 |
| InChIKey | ZOGYKCFJNOMNOU-AUXUVXAZSA-N |
| XLogP | 5.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|