C23H44O2Si — CID 11603326
tert-butyl-[1-[(3Z)-deca-1,3-dien-5-yl]oxy-5-methylhex-4-en-3-yl]oxy-dimethylsilane (PubChem CID 11603326) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is tert-butyl-[1-[(3Z)-deca-1,3-dien-5-yl]oxy-5-methylhex-4-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-[(3Z)-deca-1,3-dien-5-yl]oxy-5-methylhex-4-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11603326 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | tert-butyl-[1-[(3Z)-deca-1,3-dien-5-yl]oxy-5-methylhex-4-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C/C=C\C(CCCCC)OCCC(C=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O2Si/c1-10-12-14-16-21(15-13-11-2)24-18-17-22(19-20(3)4)25-26(8,9)23(5,6)7/h11,13,15,19,21-22H,2,10,12,14,16-18H2,1,3-9H3/b15-13- |
| InChIKey | XRDUGDRPDRRLEN-SQFISAMPSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|