C19H35BrO2Si — CID 134942346
[(3E,5Z,7S)-5-bromo-7-methoxydodeca-3,5,11-trien-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134942346) has the molecular formula C19H35BrO2Si and a molecular weight of 403.48 g/mol. Its IUPAC name is [(3E,5Z,7S)-5-bromo-7-methoxydodeca-3,5,11-trien-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3E,5Z,7S)-5-bromo-7-methoxydodeca-3,5,11-trien-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134942346 |
| Molecular Formula | C19H35BrO2Si |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [(3E,5Z,7S)-5-bromo-7-methoxydodeca-3,5,11-trien-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCCC[C@@H](/C=C(Br)/C=C/C(C)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C19H35BrO2Si/c1-9-10-11-12-18(21-6)15-17(20)14-13-16(2)22-23(7,8)19(3,4)5/h9,13-16,18H,1,10-12H2,2-8H3/b14-13+,17-15-/t16?,18-/m0/s1 |
| InChIKey | BVPCTZKJPWHXEH-JYUASIQFSA-N |
| XLogP | 6.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|