C25H44O2Si — CID 11486537
tert-butyl-[(2Z)-4-methoxy-7-methyl-6-prop-1-en-2-yl-2,3-bis(prop-2-enyl)octa-2,6-dienoxy]-dimethylsilane (PubChem CID 11486537) has the molecular formula C25H44O2Si and a molecular weight of 404.71 g/mol. Its IUPAC name is tert-butyl-[(2Z)-4-methoxy-7-methyl-6-prop-1-en-2-yl-2,3-bis(prop-2-enyl)octa-2,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2Z)-4-methoxy-7-methyl-6-prop-1-en-2-yl-2,3-bis(prop-2-enyl)octa-2,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11486537 |
| Molecular Formula | C25H44O2Si |
| Molecular Weight | 404.71 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | tert-butyl-[(2Z)-4-methoxy-7-methyl-6-prop-1-en-2-yl-2,3-bis(prop-2-enyl)octa-2,6-dienoxy]-dimethylsilane |
| SMILES | C=CC/C(CO[Si](C)(C)C(C)(C)C)=C(\CC=C)C(CC(C(=C)C)=C(C)C)OC |
| InChI | InChI=1S/C25H44O2Si/c1-13-15-21(18-27-28(11,12)25(7,8)9)22(16-14-2)24(26-10)17-23(19(3)4)20(5)6/h13-14,24H,1-3,15-18H2,4-12H3/b22-21- |
| InChIKey | RAQAOECCWPWNNX-DQRAZIAOSA-N |
| XLogP | 7.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.71 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|