C28H54O4Si2 — CID 11511824
tert-butyl-[[(2R,3R,6Z,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(1Z)-2-methoxy-3-methylbuta-1,3-dienyl]-7-methyl-2,3,4,5,8,9-hexahydrooxonin-2-yl]methoxy]-dimethylsilane (PubChem CID 11511824) has the molecular formula C28H54O4Si2 and a molecular weight of 510.91 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R,6Z,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(1Z)-2-methoxy-3-methylbuta-1,3-dienyl]-7-methyl-2,3,4,5,8,9-hexahydrooxonin-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3R,6Z,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(1Z)-2-methoxy-3-methylbuta-1,3-dienyl]-7-methyl-2,3,4,5,8,9-hexahydrooxonin-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11511824 |
| Molecular Formula | C28H54O4Si2 |
| Molecular Weight | 510.91 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | tert-butyl-[[(2R,3R,6Z,9R)-3-[tert-butyl(dimethyl)silyl]oxy-9-[(1Z)-2-methoxy-3-methylbuta-1,3-dienyl]-7-methyl-2,3,4,5,8,9-hexahydrooxonin-2-yl]methoxy]-dimethylsilane |
| SMILES | C=C(C)/C(=C/[C@H]1C/C(C)=C\CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1)OC |
| InChI | InChI=1S/C28H54O4Si2/c1-21(2)25(29-10)19-23-18-22(3)16-15-17-24(32-34(13,14)28(7,8)9)26(31-23)20-30-33(11,12)27(4,5)6/h16,19,23-24,26H,1,15,17-18,20H2,2-14H3/b22-16-,25-19-/t23-,24-,26-/m1/s1 |
| InChIKey | IDVUFAKAUOTPJP-DJOMEWGESA-N |
| XLogP | 8.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.91 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|