C22H46O4Si2 — CID 51050719
triethyl-[(E,1S)-6-methoxy-1-[(Z,1R)-1-methoxy-2-trimethylsilyloxybut-2-enyl]-2-methylhex-2-enoxy]silane (PubChem CID 51050719) has the molecular formula C22H46O4Si2 and a molecular weight of 430.78 g/mol. Its IUPAC name is triethyl-[(E,1S)-6-methoxy-1-[(Z,1R)-1-methoxy-2-trimethylsilyloxybut-2-enyl]-2-methylhex-2-enoxy]silane.
| Compound Name | triethyl-[(E,1S)-6-methoxy-1-[(Z,1R)-1-methoxy-2-trimethylsilyloxybut-2-enyl]-2-methylhex-2-enoxy]silane |
|---|---|
| PubChem CID | 51050719 |
| Molecular Formula | C22H46O4Si2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | triethyl-[(E,1S)-6-methoxy-1-[(Z,1R)-1-methoxy-2-trimethylsilyloxybut-2-enyl]-2-methylhex-2-enoxy]silane |
| SMILES | C/C=C(\O[Si](C)(C)C)[C@H](OC)[C@@H](O[Si](CC)(CC)CC)/C(C)=C/CCCOC |
| InChI | InChI=1S/C22H46O4Si2/c1-11-20(25-27(8,9)10)22(24-7)21(19(5)17-15-16-18-23-6)26-28(12-2,13-3)14-4/h11,17,21-22H,12-16,18H2,1-10H3/b19-17+,20-11-/t21-,22-/m0/s1 |
| InChIKey | BVQVZQUDUCAJOZ-IRRWDCEMSA-N |
| XLogP | 6.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|