C10H19NO2 — CID 101199381
methyl (2S,3S)-3-propan-2-yl-3-propylaziridine-2-carboxylate (PubChem CID 101199381) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is methyl (2S,3S)-3-propan-2-yl-3-propylaziridine-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-propan-2-yl-3-propylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 101199381 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | methyl (2S,3S)-3-propan-2-yl-3-propylaziridine-2-carboxylate |
| SMILES | CCC[C@@]1(C(C)C)N[C@@H]1C(=O)OC |
| InChI | InChI=1S/C10H19NO2/c1-5-6-10(7(2)3)8(11-10)9(12)13-4/h7-8,11H,5-6H2,1-4H3/t8-,10+/m1/s1 |
| InChIKey | IPYNKDZEXLOQOK-SCZZXKLOSA-N |
| XLogP | 1.33 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|