C30H36N4O6 — CID 10119986
tert-butyl 3-(hydroxycarbamoyl)-3-[[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 10119986) has the molecular formula C30H36N4O6 and a molecular weight of 548.64 g/mol. Its IUPAC name is tert-butyl 3-(hydroxycarbamoyl)-3-[[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(hydroxycarbamoyl)-3-[[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10119986 |
| Molecular Formula | C30H36N4O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | tert-butyl 3-(hydroxycarbamoyl)-3-[[[4-[(2-methylquinolin-4-yl)methoxy]benzoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | Cc1cc(COc2ccc(C(=O)NCC3(C(=O)NO)CCCN(C(=O)OC(C)(C)C)C3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C30H36N4O6/c1-20-16-22(24-8-5-6-9-25(24)32-20)17-39-23-12-10-21(11-13-23)26(35)31-18-30(27(36)33-38)14-7-15-34(19-30)28(37)40-29(2,3)4/h5-6,8-13,16,38H,7,14-15,17-19H2,1-4H3,(H,31,35)(H,33,36) |
| InChIKey | NQCXKWCMHRGRQN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|