C17H36O4Si — CID 101200540
methyl (2R,3R)-2,3-dihydroxy-2-methyl-3-trimethylsilyldodecanoate (PubChem CID 101200540) has the molecular formula C17H36O4Si and a molecular weight of 332.56 g/mol. Its IUPAC name is methyl (2R,3R)-2,3-dihydroxy-2-methyl-3-trimethylsilyldodecanoate.
| Compound Name | methyl (2R,3R)-2,3-dihydroxy-2-methyl-3-trimethylsilyldodecanoate |
|---|---|
| PubChem CID | 101200540 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | methyl (2R,3R)-2,3-dihydroxy-2-methyl-3-trimethylsilyldodecanoate |
| SMILES | CCCCCCCCC[C@](O)([C@](C)(O)C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C17H36O4Si/c1-7-8-9-10-11-12-13-14-17(20,22(4,5)6)16(2,19)15(18)21-3/h19-20H,7-14H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | WAMBAJPCSJTKBB-IAGOWNOFSA-N |
| XLogP | 3.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|