C22H44O4Si — CID 134998310
(2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilyldecyl]-2,5-dimethyl-1,3-dioxolan-4-one (PubChem CID 134998310) has the molecular formula C22H44O4Si and a molecular weight of 400.68 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilyldecyl]-2,5-dimethyl-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilyldecyl]-2,5-dimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 134998310 |
| Molecular Formula | C22H44O4Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilyldecyl]-2,5-dimethyl-1,3-dioxolan-4-one |
| SMILES | CCCCCCCCC[C@](O)([C@@]1(C)O[C@](C)(C(C)(C)C)OC1=O)[Si](C)(C)C |
| InChI | InChI=1S/C22H44O4Si/c1-10-11-12-13-14-15-16-17-22(24,27(7,8)9)20(5)18(23)25-21(6,26-20)19(2,3)4/h24H,10-17H2,1-9H3/t20-,21+,22+/m0/s1 |
| InChIKey | QMFANXOIBFYWGF-BHDDXSALSA-N |
| XLogP | 5.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|