C15H30O4Si — CID 134998307
(2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylpropyl]-2,5-dimethyl-1,3-dioxolan-4-one (PubChem CID 134998307) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylpropyl]-2,5-dimethyl-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylpropyl]-2,5-dimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 134998307 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylpropyl]-2,5-dimethyl-1,3-dioxolan-4-one |
| SMILES | CC[C@](O)([C@@]1(C)O[C@](C)(C(C)(C)C)OC1=O)[Si](C)(C)C |
| InChI | InChI=1S/C15H30O4Si/c1-10-15(17,20(7,8)9)13(5)11(16)18-14(6,19-13)12(2,3)4/h17H,10H2,1-9H3/t13-,14+,15+/m0/s1 |
| InChIKey | VXAYJUXEDFRZQV-RRFJBIMHSA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|