C14H28O4Si — CID 134998306
(2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylethyl]-2,5-dimethyl-1,3-dioxolan-4-one (PubChem CID 134998306) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylethyl]-2,5-dimethyl-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylethyl]-2,5-dimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 134998306 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylethyl]-2,5-dimethyl-1,3-dioxolan-4-one |
| SMILES | CC(C)(C)[C@]1(C)OC(=O)[C@@](C)([C@](C)(O)[Si](C)(C)C)O1 |
| InChI | InChI=1S/C14H28O4Si/c1-11(2,3)14(6)17-10(15)12(4,18-14)13(5,16)19(7,8)9/h16H,1-9H3/t12-,13+,14+/m0/s1 |
| InChIKey | VRUVNHUMAMLXIA-BFHYXJOUSA-N |
| XLogP | 2.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|