C13H26O4Si — CID 134998093
(2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylethyl]-5-methyl-1,3-dioxolan-4-one (PubChem CID 134998093) has the molecular formula C13H26O4Si and a molecular weight of 274.43 g/mol. Its IUPAC name is (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylethyl]-5-methyl-1,3-dioxolan-4-one.
| Compound Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylethyl]-5-methyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 134998093 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2S,5S)-2-tert-butyl-5-[(1R)-1-hydroxy-1-trimethylsilylethyl]-5-methyl-1,3-dioxolan-4-one |
| SMILES | CC(C)(C)[C@@H]1OC(=O)[C@@](C)([C@](C)(O)[Si](C)(C)C)O1 |
| InChI | InChI=1S/C13H26O4Si/c1-11(2,3)10-16-9(14)12(4,17-10)13(5,15)18(6,7)8/h10,15H,1-8H3/t10-,12+,13-/m1/s1 |
| InChIKey | YLHAJGYPDWLOFM-KGYLQXTDSA-N |
| XLogP | 2.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|