C13H26O5Si — CID 10356899
(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 10356899) has the molecular formula C13H26O5Si and a molecular weight of 290.43 g/mol. Its IUPAC name is (4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 10356899 |
| Molecular Formula | C13H26O5Si |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C13H26O5Si/c1-12(2,3)19(6,7)16-8-9-10(11(14)15)18-13(4,5)17-9/h9-10H,8H2,1-7H3,(H,14,15)/t9-,10+/m0/s1 |
| InChIKey | OSILGBDEVGALRB-VHSXEESVSA-N |
| XLogP | 2.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|