C14H28O5Si — CID 91701870
methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate (PubChem CID 91701870) has the molecular formula C14H28O5Si and a molecular weight of 304.46 g/mol. Its IUPAC name is methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate.
| Compound Name | methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate |
|---|---|
| PubChem CID | 91701870 |
| Molecular Formula | C14H28O5Si |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | methyl 2-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)acetate |
| SMILES | COC(=O)C(O[Si](C)(C)C(C)(C)C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C14H28O5Si/c1-13(2,3)20(7,8)19-11(12(15)16-6)10-9-17-14(4,5)18-10/h10-11H,9H2,1-8H3 |
| InChIKey | IRTFOXWHBZJAIX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|