About 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid
5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 15372076) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid.
Analyze 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid (CID 15372076) is 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid is CC1(C)OC(C(C)(C)C)C(C)(C(=O)O)O1.
What is the InChIKey of 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid?
The InChIKey is YFXNWYVRQICADZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-9(2,3)7-11(6,8(12)13)15-10(4,5)14-7/h7H,1-6H3,(H,12,13).
What are the key properties of 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid?
5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid has a molecular weight of 216.28 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2,2,4-trimethyl-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 15372076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).