C30H32N6O5 — CID 10120258
N-[2,4-dioxo-7-(piperidine-4-carbonyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide (PubChem CID 10120258) has the molecular formula C30H32N6O5 and a molecular weight of 556.62 g/mol. Its IUPAC name is N-[2,4-dioxo-7-(piperidine-4-carbonyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide.
| Compound Name | N-[2,4-dioxo-7-(piperidine-4-carbonyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 10120258 |
| Molecular Formula | C30H32N6O5 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | N-[2,4-dioxo-7-(piperidine-4-carbonyl)-1,3,7-triazaspiro[4.4]nonan-9-yl]-4-[(2-methylquinolin-4-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccc(C(=O)NC3CN(C(=O)C4CCNCC4)CC34NC(=O)NC4=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C30H32N6O5/c1-18-14-21(23-4-2-3-5-24(23)32-18)16-41-22-8-6-19(7-9-22)26(37)33-25-15-36(27(38)20-10-12-31-13-11-20)17-30(25)28(39)34-29(40)35-30/h2-9,14,20,25,31H,10-13,15-17H2,1H3,(H,33,37)(H2,34,35,39,40) |
| InChIKey | XGSHOEUVEFFPRH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|