C25H24N4O4 — CID 10203887
N-(2,4-dioxo-9-oxa-1,3-diazaspiro[4.5]decan-6-yl)-4-[(2-methylquinolin-4-yl)methyl]benzamide (PubChem CID 10203887) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-(2,4-dioxo-9-oxa-1,3-diazaspiro[4.5]decan-6-yl)-4-[(2-methylquinolin-4-yl)methyl]benzamide.
| Compound Name | N-(2,4-dioxo-9-oxa-1,3-diazaspiro[4.5]decan-6-yl)-4-[(2-methylquinolin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 10203887 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-(2,4-dioxo-9-oxa-1,3-diazaspiro[4.5]decan-6-yl)-4-[(2-methylquinolin-4-yl)methyl]benzamide |
| SMILES | Cc1cc(Cc2ccc(C(=O)NC3CCOCC34NC(=O)NC4=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C25H24N4O4/c1-15-12-18(19-4-2-3-5-20(19)26-15)13-16-6-8-17(9-7-16)22(30)27-21-10-11-33-14-25(21)23(31)28-24(32)29-25/h2-9,12,21H,10-11,13-14H2,1H3,(H,27,30)(H2,28,29,31,32) |
| InChIKey | FMZWOUSXKIWFOE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|