C15H21NO3 — CID 101203275
methyl (2R,10S,11S)-5-oxo-6-azatricyclo[8.3.1.02,6]tetradec-1(13)-ene-11-carboxylate (PubChem CID 101203275) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is methyl (2R,10S,11S)-5-oxo-6-azatricyclo[8.3.1.02,6]tetradec-1(13)-ene-11-carboxylate.
| Compound Name | methyl (2R,10S,11S)-5-oxo-6-azatricyclo[8.3.1.02,6]tetradec-1(13)-ene-11-carboxylate |
|---|---|
| PubChem CID | 101203275 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | methyl (2R,10S,11S)-5-oxo-6-azatricyclo[8.3.1.02,6]tetradec-1(13)-ene-11-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C2C[C@@H]1CCCN1C(=O)CC[C@H]21 |
| InChI | InChI=1S/C15H21NO3/c1-19-15(18)12-5-4-11-9-10(12)3-2-8-16-13(11)6-7-14(16)17/h4,10,12-13H,2-3,5-9H2,1H3/t10-,12-,13+/m0/s1 |
| InChIKey | OCVLZAHQPDJSLQ-WCFLWFBJSA-N |
| XLogP | 1.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|