C15H23NO3 — CID 24828220
methyl 5-[(8aS)-8a-methyl-5-oxo-1,2,3,8-tetrahydroindolizin-7-yl]pentanoate (PubChem CID 24828220) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is methyl 5-[(8aS)-8a-methyl-5-oxo-1,2,3,8-tetrahydroindolizin-7-yl]pentanoate.
| Compound Name | methyl 5-[(8aS)-8a-methyl-5-oxo-1,2,3,8-tetrahydroindolizin-7-yl]pentanoate |
|---|---|
| PubChem CID | 24828220 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | methyl 5-[(8aS)-8a-methyl-5-oxo-1,2,3,8-tetrahydroindolizin-7-yl]pentanoate |
| SMILES | COC(=O)CCCCC1=CC(=O)N2CCC[C@@]2(C)C1 |
| InChI | InChI=1S/C15H23NO3/c1-15-8-5-9-16(15)13(17)10-12(11-15)6-3-4-7-14(18)19-2/h10H,3-9,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | HTZJMBWYPRBOMB-HNNXBMFYSA-N |
| XLogP | 2.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|