C16H23NO3 — CID 101203261
methyl (2R,11S,12S)-5-oxo-6-azatricyclo[9.3.1.02,6]pentadec-1(14)-ene-12-carboxylate (PubChem CID 101203261) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is methyl (2R,11S,12S)-5-oxo-6-azatricyclo[9.3.1.02,6]pentadec-1(14)-ene-12-carboxylate.
| Compound Name | methyl (2R,11S,12S)-5-oxo-6-azatricyclo[9.3.1.02,6]pentadec-1(14)-ene-12-carboxylate |
|---|---|
| PubChem CID | 101203261 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | methyl (2R,11S,12S)-5-oxo-6-azatricyclo[9.3.1.02,6]pentadec-1(14)-ene-12-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C2C[C@@H]1CCCCN1C(=O)CC[C@H]21 |
| InChI | InChI=1S/C16H23NO3/c1-20-16(19)13-6-5-12-10-11(13)4-2-3-9-17-14(12)7-8-15(17)18/h5,11,13-14H,2-4,6-10H2,1H3/t11-,13-,14+/m0/s1 |
| InChIKey | MXDDUGQBWITVOK-FPMFFAJLSA-N |
| XLogP | 2.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|