C20H28O2S — CID 101203336
(1S,3aS,4R,4aS,8aR,9aS)-1-methoxy-4-(phenylsulfanylmethyl)-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran (PubChem CID 101203336) has the molecular formula C20H28O2S and a molecular weight of 332.51 g/mol. Its IUPAC name is (1S,3aS,4R,4aS,8aR,9aS)-1-methoxy-4-(phenylsulfanylmethyl)-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran.
| Compound Name | (1S,3aS,4R,4aS,8aR,9aS)-1-methoxy-4-(phenylsulfanylmethyl)-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran |
|---|---|
| PubChem CID | 101203336 |
| Molecular Formula | C20H28O2S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (1S,3aS,4R,4aS,8aR,9aS)-1-methoxy-4-(phenylsulfanylmethyl)-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran |
| SMILES | CO[C@H]1OC[C@@H]2[C@H](CSc3ccccc3)[C@H]3CCCC[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C20H28O2S/c1-21-20-17-11-14-7-5-6-10-16(14)19(18(17)12-22-20)13-23-15-8-3-2-4-9-15/h2-4,8-9,14,16-20H,5-7,10-13H2,1H3/t14-,16+,17+,18+,19-,20+/m1/s1 |
| InChIKey | KCZJEWVKMGTPMP-HRKNKHRHSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |