C21H30O4S — CID 70207306
(1R,3R,3aR,8aS,9aR)-4-(benzenesulfonylmethyl)-1-methoxy-3-methyl-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran (PubChem CID 70207306) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is (1R,3R,3aR,8aS,9aR)-4-(benzenesulfonylmethyl)-1-methoxy-3-methyl-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran.
| Compound Name | (1R,3R,3aR,8aS,9aR)-4-(benzenesulfonylmethyl)-1-methoxy-3-methyl-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran |
|---|---|
| PubChem CID | 70207306 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (1R,3R,3aR,8aS,9aR)-4-(benzenesulfonylmethyl)-1-methoxy-3-methyl-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran |
| SMILES | CO[C@@H]1O[C@H](C)[C@H]2C(CS(=O)(=O)c3ccccc3)C3CCCC[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C21H30O4S/c1-14-20-18(21(24-2)25-14)12-15-8-6-7-11-17(15)19(20)13-26(22,23)16-9-4-3-5-10-16/h3-5,9-10,14-15,17-21H,6-8,11-13H2,1-2H3/t14-,15+,17?,18-,19?,20-,21-/m1/s1 |
| InChIKey | FGPBZFDAQHSKMB-UBRCIFNTSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |