C17H24O4S — CID 139962000
4-(benzenesulfonylmethyl)-1-methoxy-3-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran (PubChem CID 139962000) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-1-methoxy-3-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran.
| Compound Name | 4-(benzenesulfonylmethyl)-1-methoxy-3-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran |
|---|---|
| PubChem CID | 139962000 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-1-methoxy-3-methyl-1,3,3a,4,5,6,7,7a-octahydro-2-benzofuran |
| SMILES | COC1OC(C)C2C(CS(=O)(=O)c3ccccc3)CCCC12 |
| InChI | InChI=1S/C17H24O4S/c1-12-16-13(7-6-10-15(16)17(20-2)21-12)11-22(18,19)14-8-4-3-5-9-14/h3-5,8-9,12-13,15-17H,6-7,10-11H2,1-2H3 |
| InChIKey | HWXSNPAGQIWUHY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |