C17H29NO2 — CID 101203695
(4E)-4-[(3aS,7aR)-7a-(hydroxymethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]-N,N-dimethylpentanamide (PubChem CID 101203695) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is (4E)-4-[(3aS,7aR)-7a-(hydroxymethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]-N,N-dimethylpentanamide.
| Compound Name | (4E)-4-[(3aS,7aR)-7a-(hydroxymethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]-N,N-dimethylpentanamide |
|---|---|
| PubChem CID | 101203695 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | (4E)-4-[(3aS,7aR)-7a-(hydroxymethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]-N,N-dimethylpentanamide |
| SMILES | C/C(CCC(=O)N(C)C)=C1/CC[C@@H]2CCCC[C@]12CO |
| InChI | InChI=1S/C17H29NO2/c1-13(7-10-16(20)18(2)3)15-9-8-14-6-4-5-11-17(14,15)12-19/h14,19H,4-12H2,1-3H3/b15-13+/t14-,17+/m0/s1 |
| InChIKey | FEBQJLQGDNEXJC-KFZAQANCSA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|