C19H19Cl4NO5 — CID 101203755
tert-butyl 4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboperoxoate (PubChem CID 101203755) has the molecular formula C19H19Cl4NO5 and a molecular weight of 483.18 g/mol. Its IUPAC name is tert-butyl 4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboperoxoate.
| Compound Name | tert-butyl 4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboperoxoate |
|---|---|
| PubChem CID | 101203755 |
| Molecular Formula | C19H19Cl4NO5 |
| Molecular Weight | 483.18 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | tert-butyl 4-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)cyclohexane-1-carboperoxoate |
| SMILES | CC(C)(C)OOC(=O)C1CCC(N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)CC1 |
| InChI | InChI=1S/C19H19Cl4NO5/c1-19(2,3)29-28-18(27)8-4-6-9(7-5-8)24-16(25)10-11(17(24)26)13(21)15(23)14(22)12(10)20/h8-9H,4-7H2,1-3H3 |
| InChIKey | UAQZQBOPXDNQDY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.18 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|