C6H2F2 — CID 101204620
3-(difluoromethylidene)penta-1,4-diyne (PubChem CID 101204620) has the molecular formula C6H2F2 and a molecular weight of 112.08 g/mol. Its IUPAC name is 3-(difluoromethylidene)penta-1,4-diyne.
| Compound Name | 3-(difluoromethylidene)penta-1,4-diyne |
|---|---|
| PubChem CID | 101204620 |
| Molecular Formula | C6H2F2 |
| Molecular Weight | 112.08 g/mol |
| Exact Mass | 112.01 |
| IUPAC Name | 3-(difluoromethylidene)penta-1,4-diyne |
| SMILES | C#CC(C#C)=C(F)F |
| InChI | InChI=1S/C6H2F2/c1-3-5(4-2)6(7)8/h1-2H |
| InChIKey | YRGLLDDFXUXJES-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.08 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|