C8H9F2N — CID 143518126
(3Z,5E)-3,5-difluoro-N-methylhepta-3,5-dien-1-yn-4-amine (PubChem CID 143518126) has the molecular formula C8H9F2N and a molecular weight of 157.16 g/mol. Its IUPAC name is (3Z,5E)-3,5-difluoro-N-methylhepta-3,5-dien-1-yn-4-amine.
| Compound Name | (3Z,5E)-3,5-difluoro-N-methylhepta-3,5-dien-1-yn-4-amine |
|---|---|
| PubChem CID | 143518126 |
| Molecular Formula | C8H9F2N |
| Molecular Weight | 157.16 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (3Z,5E)-3,5-difluoro-N-methylhepta-3,5-dien-1-yn-4-amine |
| SMILES | C#C/C(F)=C(NC)\C(F)=C/C |
| InChI | InChI=1S/C8H9F2N/c1-4-6(9)8(11-3)7(10)5-2/h1,5,11H,2-3H3/b7-5+,8-6- |
| InChIKey | HCYDJVNEVQEHTJ-YMBWGVAGSA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|