C8H10FN — CID 163869241
(2E,4E)-4-fluoroocta-2,4-dien-7-yn-3-amine (PubChem CID 163869241) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is (2E,4E)-4-fluoroocta-2,4-dien-7-yn-3-amine.
| Compound Name | (2E,4E)-4-fluoroocta-2,4-dien-7-yn-3-amine |
|---|---|
| PubChem CID | 163869241 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | (2E,4E)-4-fluoroocta-2,4-dien-7-yn-3-amine |
| SMILES | C#CC/C=C(F)\C(N)=C/C |
| InChI | InChI=1S/C8H10FN/c1-3-5-6-7(9)8(10)4-2/h1,4,6H,5,10H2,2H3/b7-6+,8-4+ |
| InChIKey | PJIOEUPDHUGTBB-CUXHJGIESA-N |
| XLogP | 1.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|