C10H16N2 — CID 130372367
(1Z,3E)-1-N-methyl-3-prop-2-ynylhexa-1,3-diene-1,2-diamine (PubChem CID 130372367) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (1Z,3E)-1-N-methyl-3-prop-2-ynylhexa-1,3-diene-1,2-diamine.
| Compound Name | (1Z,3E)-1-N-methyl-3-prop-2-ynylhexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 130372367 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (1Z,3E)-1-N-methyl-3-prop-2-ynylhexa-1,3-diene-1,2-diamine |
| SMILES | C#CCC(=C\CC)/C(N)=C/NC |
| InChI | InChI=1S/C10H16N2/c1-4-6-9(7-5-2)10(11)8-12-3/h1,7-8,12H,5-6,11H2,2-3H3/b9-7+,10-8- |
| InChIKey | QWNQBRREJNMDHZ-ZWOQCJTASA-N |
| XLogP | 1.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|