C13H9IN4O — CID 101205558
5-iodo-N-[3-(1,3-oxazol-2-yl)phenyl]pyrimidin-4-amine (PubChem CID 101205558) has the molecular formula C13H9IN4O and a molecular weight of 364.15 g/mol. Its IUPAC name is 5-iodo-N-[3-(1,3-oxazol-2-yl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-iodo-N-[3-(1,3-oxazol-2-yl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 101205558 |
| Molecular Formula | C13H9IN4O |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 5-iodo-N-[3-(1,3-oxazol-2-yl)phenyl]pyrimidin-4-amine |
| SMILES | Ic1cncnc1Nc1cccc(-c2ncco2)c1 |
| InChI | InChI=1S/C13H9IN4O/c14-11-7-15-8-17-12(11)18-10-3-1-2-9(6-10)13-16-4-5-19-13/h1-8H,(H,15,17,18) |
| InChIKey | AOBRNKVLJCHZGL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|